| Identification |
| Name: | 1H-Imidazole,2-(2-ethyl-2,3-dihydro-2-benzofuranyl)- |
| Synonyms: | KU 14R;2-(2-Ethyl-2,3-dihydrobenzofuran-2-yl)-1H-imidazole; |
| CAS: | 189224-48-4 |
| Molecular Formula: | C13H14N2O |
| Molecular Weight: | 214.26 |
| InChI: | InChI=1/C13H14N2O/c1-2-13(12-14-7-8-15-12)9-10-5-3-4-6-11(10)16-13/h3-8H,2,9H2,1H3,(H,14,15) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 137-139ºC |
| Flash Point: | 154.4°C |
| Boiling Point: | 428.1°Cat760mmHg |
| Density: | 1.181g/cm3 |
| Refractive index: | 1.595 |
| Water Solubility: | souble in 100mM in DMSO |
| Solubility: | souble in 100mM in DMSO |
| Appearance: | White Solid |
| Biological Activity: | Antagonist of the atypical imidazoline binding site (putative I 3 receptor) of pancreatic β -cells. Selectively blocks efaroxan-induced insulin secretion in vitro and in vivo . |
| Flash Point: | 154.4°C |
| Safety Data |
| |
 |
