| Identification | |
| Name: | 2H-1-Benzopyran-3(4H)-one |
| Synonyms: | 3-Chromanone(7CI,8CI); |
| CAS: | 19090-04-1 |
| Molecular Formula: | C9H8O2 |
| Molecular Weight: | 148.16 |
| InChI: | InChI=1/C9H8O2/c10-8-5-7-3-1-2-4-9(7)11-6-8/h1-4H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.197 g/cm3 |
| Refractive index: | 1.562 |
| Specification: |
The 3-Chromanone with the CAS number 19090-04-1 is also called 2H-1-Benzopyran-3(4H)-one. The systematic name is 2H-chromen-3(4H)-one. Its molecular formula is C9H8O2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 2.40; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1; (4)ACD/LogD (pH 7.4): 1; (5)ACD/BCF (pH 5.5): 4; (6)ACD/BCF (pH 7.4): 4; (7)ACD/KOC (pH 5.5): 91; (8)ACD/KOC (pH 7.4): 91; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 26.3Å2; (13)Index of Refraction: 1.562; (14)Molar Refractivity: 40.163 cm3; (15)Molar Volume: 123.804 cm3; (16)Polarizability: 15.922×10-24cm3; (17)Surface Tension: 43.546 dyne/cm; (18)Enthalpy of Vaporization: 52.025 kJ/mol; (19)Vapour Pressure: 0.004 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
