Identification |
Name: | Benzenamine,N-hydroxy-N-methyl-4-(2-phenyldiazenyl)- |
Synonyms: | Benzenamine,N-hydroxy-N-methyl-4-(phenylazo)- (9CI); Hydroxylamine,N-methyl-N-[p-(phenylazo)phenyl]- (8CI); 4-(N-Hydroxy-N-methylamino)azobenzene;N-Hydroxy-N-methyl-4-aminoazobenzene |
CAS: | 1910-36-7 |
Molecular Formula: | C13H13 N3 O |
Molecular Weight: | 227.29 |
InChI: | InChI=1/C13H13N3O/c1-16(17)13-9-7-12(8-10-13)15-14-11-5-3-2-4-6-11/h2-10,17H,1H3/b15-14+ |
Molecular Structure: |
![(C13H13N3O) Benzenamine,N-hydroxy-N-methyl-4-(phenylazo)- (9CI); Hydroxylamine,N-methyl-N-[p-(phenylazo)phenyl]-...](https://img1.guidechem.com/chem/e/dict/39/1910-36-7.jpg) |
Properties |
Flash Point: | 195.7°C |
Boiling Point: | 399.9°Cat760mmHg |
Density: | 1.12g/cm3 |
Refractive index: | 1.59 |
Specification: |
N-Hydroxy-4-(methylamino)azobenzene , its cas register number is 1910-36-7. It also can be called N-Hydroxy-N-methyl-4-aminoazobenzene ; N-Methyl-N-(p-(phenylazo)phenyl)hydroxylamine ; Benzenamine, N-hydroxy-N-methyl-4-(phenylazo)- ; and N-Hydroxy-mab .
|
Flash Point: | 195.7°C |
Safety Data |
|
 |