| Identification | |
| Name: | 1-Naphthalenecarboxylicacid, 1,2,3,4-tetrahydro- |
| Synonyms: | 1-Naphthoicacid, 1,2,3,4-tetrahydro- (6CI,7CI,8CI);1,2,3,4-Tetrahydro-a-naphthoic acid;1,2,3,4-Tetrahydronaphthalene-1-carboxylic acid;1-Tetralincarboxylic acid; |
| CAS: | 1914-65-4 |
| Molecular Formula: | C11H12O2 |
| Molecular Weight: | 176.21 |
| InChI: | InChI=1/C11H12O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.186 g/cm3 |
| Refractive index: | 1.576 |
| Specification: |
1,2,3,4-Tetrahydro-1-naphthoic acid , its cas register number is 1914-65-4. It also can be called 1-Naphthalenecarboxylic acid, 1,2,3,4-tetrahydro- ; and 1,2,3,4-Tetrahydronaphthalene-1-carboxylic acid . |
| Safety Data | |
 |
|
