| Identification | |
| Name: | 5-Indazolamine |
| Synonyms: | 1H-Indazole,5-amino- (6CI,7CI,8CI);1H-Indazol-5-ylamine;5-Amino-1H-indazole;5-Aminobenzopyrazole;5-Aminoindazole;NSC44676; |
| CAS: | 19335-11-6 |
| EINECS: | 242-971-5 |
| Molecular Formula: | C7H7N3 |
| Molecular Weight: | 133.15 |
| InChI: | InChI=1/C7H7N3/c8-6-1-2-7-5(3-6)4-9-10-7/h1-4H,8H2,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.367 g/cm3 |
| Refractive index: | 1.806 |
| Water Solubility: | Solubile in Methanol |
| Solubility: | Solubile in Methanol |
| Appearance: | gray to purple-brown powder. |
| Specification: |
1H-Indazol-5-amine (CAS NO.19335-11-6), its Synonyms are Indazol-5-ylamine ; 1H-Indazole, 5-amino- ; 5-Amino-1H-indazole ; 5-Aminoindazole . It is white to light yellow crystal powder. Its raw materials are Acetic acid glacial ; Sodium nitrite ; Palladium ; 2-Methyl-4-nitroaniline . |
| Packinggroup: | III |
| Safety Data | |
 |
|
