| Identification | |
| Name: | 2-Propenoylisothiocyanate, 3-phenyl- |
| Synonyms: | Cinnamic acid,anhydride with isothiocyanic acid (7CI,8CI); Cinnamoyl isothiocyanate (8CI);Isothiocyanic acid, anhydride with cinnamic acid (8CI); 3-Phenylpropenoylisothiocyanate |
| CAS: | 19495-08-0 |
| Molecular Formula: | C10H7 N O S |
| Molecular Weight: | 189.23 |
| InChI: | InChI=1/C10H7NOS/c12-10(11-8-13)7-6-9-4-2-1-3-5-9/h1-7H/b7-6+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 43-45°C |
| Flash Point: | 142.4°C |
| Boiling Point: | 311.9°Cat760mmHg |
| Density: | 1.07g/cm3 |
| Refractive index: | 1.566 |
| Flash Point: | 142.4°C |
| Safety Data | |
 |
|
