| Identification | |
| Name: | 1,2-Diazenedicarboxylicacid, 1,2-diethyl ester |
| Synonyms: | Diazenedicarboxylicacid, diethyl ester (9CI);Formic acid, azodi-, diethyl ester (6CI,8CI);1,2-Ethoxycarbonyl diazene;Azodicarboxylic acid diethyl ester;DEAD;Diethoxycarbonyldiazene;Diethyl azodicarboxylate;Diethyl diazenedicarboxylate;Diethyl diazodicarboxylate;NSC 3474;NSC 679015;Unifoam AZ-AE 200; |
| CAS: | 1972-28-7 |
| EINECS: | 217-821-7 |
| Molecular Formula: | C6H10N2O4 |
| Molecular Weight: | 174.16 |
| InChI: | InChI=1/C6H10N2O4/c1-5(9)11-3-7-8-4-12-6(2)10/h3-4H2,1-2H3/b8-7+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3233 |
| Flash Point: | 106.9°C |
| Density: | 1.106 |
| Stability: | Stable, but may explode if heated under confinement. May be shock sensitive. Decomposes vigorously if heated above 100 C. Incompatible with strong acids, strong bases, strong oxidizing agents, strong reducing agents. Light sensitive. |
| Refractive index: | n20/D 1.47 |
| Solubility: | |
| Appearance: | red to orange liquid |
| Packinggroup: | III |
| Flash Point: | 106.9°C |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air Sensitive |
| Usage: | An efficient component in diels-alder reactions. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
 |
|
