Identification |
Name: | 1,2-Diazenedicarboxylicacid, 1,2-bis(phenylmethyl) ester |
Synonyms: | Diazenedicarboxylicacid, bis(phenylmethyl) ester (9CI);Formic acid, azodi-, dibenzyl ester(6CI,7CI,8CI);Dibenzyl azodicarboxylate;NSC 620564; |
CAS: | 2449-05-0 |
EINECS: | 219-508-0 |
Molecular Formula: | C16H14N2O4 |
Molecular Weight: | 298.29 |
InChI: | InChI=1/C16H14N2O4/c19-15(21-11-13-7-3-1-4-8-13)17-18-16(20)22-12-14-9-5-2-6-10-14/h1-10H,11-12H2/b18-17+ |
Molecular Structure: |
|
Properties |
Density: | 1.19 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.567 |
Solubility: | Insoluble |
Appearance: | Yellow to orange crystalline powder |
Storage Temperature: | 0-6°C |
Safety Data |
Hazard Symbols |
F:Flammable
Xi:Irritant
|
|
|