Identification |
Name: | 2-Methyl-3-nitrobenzoic acid |
Synonyms: | 3-Nitro-o-toluic acid; 3-Nitro-2-Methyl Benzoic Acid; 3-Nitro-2-Methyl benzoic acid |
CAS: | 1975-50-4 |
EINECS: | 217-826-4 |
Molecular Formula: | C8H7NO4 |
Molecular Weight: | 181.15 |
InChI: | InChI=1/C8H7NO4/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3,(H,10,11) |
Molecular Structure: |
|
Properties |
Transport: | 50kgs |
Density: | 1.392 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Water Solubility: | Insoluble
AUTOIGNITION |
Solubility: | Insoluble AUTOIGNITION |
Appearance: | White to slightly yellow crystalline powder |
HS Code: | 29163900 |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|