Identification |
Name: | 3-Methyl-4-nitrobenzoic acid |
Synonyms: | 4-Nitro-m-toluic acid; 3-Methy-4-nitrobenzoatic Acid; 4-Nitro-3-Methyl benzoic acid |
CAS: | 3113-71-1 |
EINECS: | 221-479-4 |
Molecular Formula: | C8H7NO4 |
Molecular Weight: | 181.15 |
InChI: | InChI=1/C8H7NO4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h2-4H,1H3,(H,10,11) |
Molecular Structure: |
 |
Properties |
Transport: | 50kgs |
Flash Point: | 161.2oC |
Boiling Point: | 356oC |
Density: | 1.392 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Water Solubility: | AUTOIGNITION |
Solubility: | AUTOIGNITION |
Appearance: | yellowish to yellow crystalline powder |
HS Code: | 29163900 |
Flash Point: | 161.2oC |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |