| Identification | |
| Name: | 2,6-Dichloroanisole |
| Synonyms: | Dichloroanisole; 98% |
| CAS: | 1984-65-2 |
| EINECS: | 217-855-2 |
| Molecular Formula: | C7H6Cl2O |
| Molecular Weight: | 177.03 |
| InChI: | InChI=1/C7H6Cl2O/c1-10-7-5(8)3-2-4-6(7)9/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.29 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.542-1.544 |
| Solubility: | Insoluble |
| Appearance: | Clear, colorless liquid. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
