| Identification | |
| Name: | D-Altrose |
| Synonyms: | Altrose, D-(8CI); NSC 2573 |
| CAS: | 1990-29-0 |
| EINECS: | 217-870-4 |
| Molecular Formula: | C6H12 O6 |
| Molecular Weight: | 180.16 |
| InChI: | InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4-,5+,6+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 106-108 °C |
| Flash Point: | 286.7°C |
| Boiling Point: | 527.1°Cat760mmHg |
| Density: | 1.581g/cm3 |
| Refractive index: | 1.635 |
| Solubility: | SOL IN HOT METHANOL; SOL IN HOT PYRIDINE; SLIGHTLY SOL IN ACETONE; SOL IN WATER; SOL IN HOT ALC Slightly soluble in alcohol. In water, ... below a temperature of ca 100 deg C, the stable, crystalline form of D-glucose is the alpha-form, which crystallizes as a monohydrate below ca 50 deg C, above ca 100 deg C, the beta-anhydrous form, is most stable. water solubility = 1.2X10+6 mg/l @ 30 deg C |
| Flash Point: | 286.7°C |
| Storage Temperature: | 2-8°C |
| Color: | Colorless crystals or white granular powder |
| Safety Data | |
 |
|
