| Identification | |
| Name: | 2-Furancarboxaldehyde,5-(4-bromophenyl)- |
| Synonyms: | 2-Furaldehyde,5-(p-bromophenyl)- (8CI);5-(4-Bromophenyl)-2-furaldehyde;5-(4-Bromophenyl)-2-furancarboxaldehyde;5-(p-Bromophenyl)-2-furaldehyde;5-(p-Bromophenyl)-2-furancarboxaldehyde;5-(p-Bromophenyl)furfural; |
| CAS: | 20005-42-9 |
| Molecular Formula: | C11H7BrO2 |
| Molecular Weight: | 251.0761 |
| InChI: | InChI=1/C11H7BrO2/c12-9-3-1-8(2-4-9)11-6-5-10(7-13)14-11/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 150-155 ºC |
| Density: | 1.518 g/cm3 |
| Refractive index: | 1.613 |
| Appearance: | Ashen yellow powder |
| Specification: |
2-Furancarboxaldehyde,5-(4-bromophenyl)- , with CAS number of 20005-42-9, can be called 5-(4-Bromophenyl)-2-furaldehyde ; 5-(4-Bromophenyl)-2-furancarbaldehyde ; 5-(4-Bromophenyl)-2-furancarboxaldehyde ; 5-(4-Bromo-phenyl)-furan-2-carbaldehyde ; 5-(4-Bromophenyl)furfural ; 5-P-Bromophenyl furancarboxaldehyde . 2-Furancarboxaldehyde,5-(4-bromophenyl)- (CAS NO.20005-42-9) is a brown powder. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
