| Identification | |
| Name: | Benzenepropanoic acid,2-nitro- |
| Synonyms: | Hydrocinnamicacid, o-nitro- (6CI,7CI,8CI); 3-(2-Nitrophenyl)propanoic acid;3-o-Nitrophenylpropionic acid; NSC 99344 |
| CAS: | 2001-32-3 |
| EINECS: | 217-889-8 |
| Molecular Formula: | C9H9 N O4 |
| Molecular Weight: | 195.17206 |
| InChI: | InChI=1/C9H9NO4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-4H,5-6H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.343g/cm3 |
| Refractive index: | 1.583 |
| Specification: |
The CAS register number of 3-(2-Nitrophenyl)propanoic acid is 2001-32-3. It also can be called as Benzenepropanoic acid,2-nitro- and the IUPAC name about this chemical is 3-(2-nitrophenyl)propanoic acid. The molecular formula about this chemical is C9H9NO4 and the molecular weight is 195.17. Physical properties about 3-(2-Nitrophenyl)propanoic acid are: (1)ACD/LogP: 1.57; (2)ACD/LogD (pH 5.5): 0.5; (3)ACD/LogD (pH 7.4): -1.3; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 14.44; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 5; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 4; (11)Polar Surface Area: 72.12Å2; (12)Index of Refraction: 1.583; (13)Molar Refractivity: 48.54 cm3; (14)Molar Volume: 145.2 cm3; (15)Polarizability: 19.24x10-24cm3; (16)Surface Tension: 58 dyne/cm; (17)Enthalpy of Vaporization: 63.15 kJ/mol; (18)Boiling Point: 353.5 °C at 760 mmHg; (19)Vapour Pressure: 1.31E-05 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
