| Identification | |
| Name: | Benzenepropanoic acid,2-nitro-a-oxo- |
| Synonyms: | Pyruvicacid, (o-nitrophenyl)- (6CI,7CI); (2-Nitrophenyl)pyruvic acid;(o-Nitrophenyl)pyruvic acid; 2-Nitro-a-oxobenzenepropanoic acid;3-(2-Nitrophenyl)-2-oxopropanoic acid; NSC 5598 |
| CAS: | 5461-32-5 |
| EINECS: | 226-746-9 |
| Molecular Formula: | C9H7 N O5 |
| Molecular Weight: | 209.16 |
| InChI: | InChI=1/C9H7NO5/c11-8(9(12)13)5-6-3-1-2-4-7(6)10(14)15/h1-4H,5H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.469 g/cm3 |
| Refractive index: | 1.598 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
 |
|
