| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 2,6-dibromo- |
| Synonyms: | Isonicotinicacid, 2,6-dibromo- (6CI,7CI,8CI);2,6-Dibromoisonicotinic acid; |
| CAS: | 2016-99-1 |
| Molecular Formula: | C6H3Br2NO2 |
| Molecular Weight: | 280.9 |
| InChI: | InChI=1/C6H3Br2NO2/c7-4-1-3(6(10)11)2-5(8)9-4/h1-2H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 248.6°C |
| Boiling Point: | 487.5°Cat760mmHg |
| Density: | 2.202g/cm3 |
| Refractive index: | 1.652 |
| Specification: |
2,6-Dibromopyridine-4-carboxylic acid , with CAS number of 2016-99-1, can be called 4-pyridinecarboxylic acid, 2,6-dibromo- ; 2,6-Dibromisonicotinsaure ; Acide 2,6-dibromoisonicotinique . |
| Flash Point: | 248.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
