| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 2-chloro-6-methyl- |
| Synonyms: | Isonicotinicacid, 2-chloro-6-methyl- (6CI,8CI);2-Chloro-6-methyl-4-pyridinecarboxylicacid;2-Chloro-6-methylisonicotinic acid; |
| CAS: | 25462-85-5 |
| Molecular Formula: | C7H6ClNO2 |
| Molecular Weight: | 171.58 |
| InChI: | InChI=1/C7H6ClNO2/c1-4-2-5(7(10)11)3-6(8)9-4/h2-3H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.39 g/cm3 |
| Refractive index: | 1.578 |
| Appearance: | brown solid |
| Specification: |
2-Chloro-6-methylpyridine-4-carboxylic acid , with CAS number of 25462-85-5, can be called 4-pyridinecarboxylic acid, 2-chloro-6-methyl- ; 2-chloro-6-methylisonicotinic acid . |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
