| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 2-chloro-, methyl ester |
| Synonyms: | 2-Chloroisonicotinicacid methyl ester;2-Chloropyridine-4-carboxylic acid methyl ester;Methyl2-chloro-4-pyridinecarboxylate;Methyl 2-chloroisonicotinate; |
| CAS: | 58481-11-1 |
| Molecular Formula: | C7H6ClNO2 |
| Molecular Weight: | 171.58 |
| InChI: | InChI=1/C7H6ClNO2/c1-11-7(10)5-2-3-9-6(8)4-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 32-36 °C |
| Flash Point: | 107.2°C |
| Boiling Point: | 253.7°Cat760mmHg |
| Density: | 1.294g/cm3 |
| Refractive index: | 1.531 |
| Specification: |
Methyl 2-chloroisonicotinate , with CAS number of 58481-11-1, can be called 4-pyridinecarboxylic acid, 2-chloro-, methyl ester ; 2-Chloroisonicotinate de methyle ; Methyl-2-chlorisonicotinat ; Methyl 2-chloropyridine-4-carboxylate . |
| Flash Point: | 107.2°C |
| Safety Data | |
 |
|
