| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 2-chloro-6-methyl- |
| Synonyms: | Nicotinicacid, 2-chloro-6-methyl- (8CI);2-Chloro-6-methyl-3-pyridinecarboxylic acid; |
| CAS: | 30529-70-5 |
| EINECS: | 250-229-7 |
| Molecular Formula: | C7H6ClNO2 |
| Molecular Weight: | 171.58 |
| InChI: | InChI=1/C7H6ClNO2/c1-4-2-3-5(7(10)11)6(8)9-4/h2-3H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.39 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | Yellow crystalline powder. |
| Specification: |
3-Pyridinecarboxylicacid, 2-chloro-6-methyl- , its cas register number is 30529-70-5. It also can be called 2-Chloro-6-methylnicotinic acid . 3-Pyridinecarboxylicacid, 2-chloro-6-methyl- (CAS NO.30529-70-5) is irritating to eyes, respiratory system and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
