| Identification | |
| Name: | 2-Benzothiazolamine,4-bromo- |
| Synonyms: | Benzothiazole,2-amino-4-bromo- (8CI);2-Amino-4-bromo-1,3-benzothiazole;2-Amino-4-bromobenzothiazole;4-Bromobenzo[d]thiazol-2-amine; |
| CAS: | 20358-02-5 |
| Molecular Formula: | C7H5BrN2S |
| Molecular Weight: | 229.10 |
| InChI: | InChI=1/C7H5BrN2S/c8-4-2-1-3-5-6(4)10-7(9)11-5/h1-3H,(H2,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.836 g/cm3 |
| Refractive index: | 1.783 |
| Specification: |
The 2-Amino-4-bromobenzothiazole, its cas register number is 20358-02-5. It also can be called as 2-Benzothiazolamine,4-bromo- and the Systematic name about this chemical is 4-Bromo-1,3-benzothiazol-2-amine. It belongs to the following product categories, such as blocks, Bromides, Thiazoles and so on. Physical properties about 2-Amino-4-bromobenzothiazole are: (1)#H bond acceptors: 2; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 0; (4)Polar Surface Area: 44.37Å2; (5)Index of Refraction: 1.783; (6)Molar Refractivity: 52.49 cm3; (7)Molar Volume: 124.7 cm3; (8)Polarizability: 20.81x10-24cm3; (9)Surface Tension: 73.1 dyne/cm; (10)Enthalpy of Vaporization: 61.33 kJ/mol; (11)Vapour Pressure: 1.42E-05 mmHg at 25°C You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
