| Identification | |
| Name: | 2-Chlorostyrene |
| Synonyms: | - |
| CAS: | 2039-87-4 |
| EINECS: | 218-026-8 |
| Molecular Formula: | C8H7Cl |
| Molecular Weight: | 138.6 |
| InChI: | InChI=1/C8H7Cl/c1-2-7-5-3-4-6-8(7)9/h2-6H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.08 |
| Stability: | Stable under normal temperatures and pressures. May discolor on exposure to light. |
| Refractive index: | 1.5638-1.5658 |
| Solubility: | Insoluble |
| Appearance: | Clear yellow liquid. |
| Specification: |
Storage of O-chlorostyren (2039-87-4): Keep away from sources of ignition. Do not store in direct sunlight. Store in a tightly closed container. Flammables-area. Refrigerator (approx 4 C). |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Refrigerator |
| Color: | Liquid Colorless liquid. |
| Usage: | O-chlorostyrene is used in the manufacture of polychlorostyrene which is a clear, colorless plastic with good foaming, heat distortion and flame-retardant properties. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
