| Identification | |
| Name: | 1H-Indole-2,3-dione,1-methyl- |
| Synonyms: | Indole-2,3-dione,1-methyl- (7CI,8CI);Isatin, 1-methyl- (6CI);1-Methyl-1H-indole-2,3-dione;1-Methyl-2,3-indolinedione;1-Methylindole-2,3-dione;1-Methylisatin;N-Methylindoline-2,3-dione;N-Methylisatin;NSC 42449;OL 57; |
| CAS: | 2058-74-4 |
| EINECS: | 218-164-9 |
| Molecular Formula: | C9H7NO2 |
| Molecular Weight: | 161.16 |
| InChI: | InChI=1/C9H7NO2/c1-10-7-5-3-2-4-6(7)8(11)9(10)12/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Flash Point: | 137.4°C |
| Boiling Point: | 294.3°Cat760mmHg |
| Density: | 1.314g/cm3 |
| Refractive index: | 1.607 |
| Appearance: | orange to brownish crystalline powder |
| Specification: | ORANGE TO BROWNISH CRYSTALLINE POWDER Safety Statements:26-39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 137.4°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
