| Identification | |
| Name: | 1H-Inden-7-ol |
| Synonyms: | Inden-7-ol(7CI,8CI) |
| CAS: | 2059-92-9 |
| Molecular Formula: | C9H8 O |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C9H8O/c10-9-6-2-4-7-3-1-5-8(7)9/h1-4,6,10H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 115.1°C |
| Boiling Point: | 256.3°C at 760 mmHg |
| Density: | 1.198g/cm3 |
| Refractive index: | 1.643 |
| Flash Point: | 115.1°C |
| Usage: | A component of coal tar. Also a useful synthetic intermediate in the production of biomolecules |
| Safety Data | |
 |
|
