| Identification | |
| Name: | Benzenecarbothioamide,3-bromo-4-(2-methylpropoxy)- |
| Synonyms: | 3-Bromo-4-isobutoxybenzothioamide |
| CAS: | 208665-96-7 |
| Molecular Formula: | C11H14 Br N O S |
| Molecular Weight: | 288.20 |
| InChI: | InChI=1/C11H14BrNOS/c1-7(2)6-14-10-4-3-8(11(13)15)5-9(10)12/h3-5,7H,6H2,1-2H3,(H2,13,15) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.398 g/cm3 |
| Refractive index: | 1.602 |
| Specification: |
The 3-Bromo-4-isobutoxybenzothioamide with the cas number 208665-96-7, is also called benzenecarbothioamide, 3-bromo-4-(2-methylpropoxy)-. The properties of the chemical are: (1)#H bond acceptors: 2; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 4; (4)Polar Surface Area: 67.34Å2; (5)Index of Refraction: 1.602; (6)Molar Refractivity: 70.669 cm3; (7)Molar Volume: 206.087 cm3; (8)Polarizability:28.015×10-24cm3 ; (9)Surface Tension: 49.663 dyne/cm; (10)Enthalpy of Vaporization: 61.772 kJ/mol; (11)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
