Identification |
Name: | ethyl (3-chloro-4-iodo-phenyl)thiocarbamoylsulfanylformate |
Synonyms: | Thiocarbonic acid anhydrosulfide with 3-chloro-4-iododithiocarbanilic acid ethyl ester;Carbonic acid, thio-, anhydrosulfide with 3-chloro-4-iododithiocarbanilic acid, ethyl ester;AC1MHUMW;LS-52110;ethyl (3-chloro-4-iodophenyl)carbamothioylsulfanylformate;20975-45-5 |
CAS: | 20975-45-5 |
Molecular Formula: | C10H9ClINO2S2 |
Molecular Weight: | 401.67143 |
InChI: | InChI=1/C10H9ClINO2S2/c1-2-15-10(14)17-9(16)13-6-3-4-8(12)7(11)5-6/h3-5H,2H2,1H3,(H,13,16) |
Molecular Structure: |
![(C10H9ClINO2S2) Thiocarbonic acid anhydrosulfide with 3-chloro-4-iododithiocarbanilic acid ethyl ester;Carbonic acid...](https://img1.guidechem.com/structure/image/20975-45-5.png) |
Properties |
Flash Point: | 210°C |
Boiling Point: | 423.6°Cat760mmHg |
Density: | 1.869g/cm3 |
Refractive index: | 1.717 |
Flash Point: | 210°C |
Safety Data |
|
![](/images/detail_15.png) |