Identification |
Name: | ethyl (4-chloro-3-methyl-phenyl)thiocarbamoylsulfanylformate |
Synonyms: | Thiocarbonic acid anhydrosulfide with 4-chloro-3-methyldithiocarbanilic acid ethyl ester;Carbonic acid, thio-, anhydrosulfide with 4-chloro-3-methyldithiocarbanilic acid, ethyl ester;AC1MHUN5;LS-52111;ethyl (4-chloro-3-methylphenyl)carbamothioylsulfanylformate;20975-53-5 |
CAS: | 20975-53-5 |
Molecular Formula: | C11H12ClNO2S2 |
Molecular Weight: | 289.80148 |
InChI: | InChI=1/C11H12ClNO2S2/c1-3-15-11(14)17-10(16)13-8-4-5-9(12)7(2)6-8/h4-6H,3H2,1-2H3,(H,13,16) |
Molecular Structure: |
![(C11H12ClNO2S2) Thiocarbonic acid anhydrosulfide with 4-chloro-3-methyldithiocarbanilic acid ethyl ester;Carbonic ac...](https://img1.guidechem.com/structure/image/20975-53-5.png) |
Properties |
Flash Point: | 183.3°C |
Boiling Point: | 379.5°Cat760mmHg |
Density: | 1.386g/cm3 |
Refractive index: | 1.653 |
Flash Point: | 183.3°C |
Safety Data |
|
![](/images/detail_15.png) |