Identification |
Name: | 2-Chloro-4-fluoronitrobenzene |
Synonyms: | 2-Chloro-4-fluoro-1-nitrobenzene;2-chloro-4-fluoro-1-nitro-benzene; |
CAS: | 2106-50-5 |
EINECS: | 218-286-2 |
Molecular Formula: | C6H3ClFNO2 |
Molecular Weight: | 175.54 |
InChI: | InChI=1/C6H3ClFNO2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H |
Molecular Structure: |
 |
Properties |
Density: | 1.494 g/cm3 |
Refractive index: | 1.554 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Storage Temperature: | Room temperature. |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |