| Identification | |
| Name: | 1-Cyclohexene-1-carboxaldehyde,4-(1-methylethenyl)- |
| CAS: | 2111-75-3 |
| EINECS: | 218-302-8 |
| Molecular Formula: | C10H14 O |
| Molecular Weight: | 150.2176 |
| InChI: | InChI=1/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | n20/D 1.509 |
| Water Solubility: | Insoluble in water; soluble in alcohols and oils |
| Solubility: | Insoluble in water; soluble in alcohols and oils |
| Appearance: | Pale, yellowish oily liquid; powerful, fatty-spicy, oily-herbaceous odour |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
