| Identification | |
| Name: | 6,11-Dihydro-4-fluoro-(1)Benzothiopyrano(4,3-b)indole |
| Synonyms: | BRN 1582683;Thiopyrano(4,3-b)benz(e)indole, 6,11-dihydro-4-fluoro-;(1)BENZOTHIOPYRANO(4,3-b)INDOLE, 6,11-DIHYDRO-4-FLUORO-;AC1L1JRG;LS-41387;4-fluoro-6,11-dihydrothiochromeno[4,3-b]indole;21243-26-5 |
| CAS: | 21243-26-5 |
| Molecular Formula: | C15H10FNS |
| Molecular Weight: | 255.31 |
| InChI: | InChI=1/C15H10FNS/c16-12-6-3-5-10-14-11(8-18-15(10)12)9-4-1-2-7-13(9)17-14/h1-7,17H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 238.8°C |
| Boiling Point: | 471.2°C at 760 mmHg |
| Density: | 1.401g/cm3 |
| Refractive index: | 1.749 |
| Specification: |
6,11-Dihydro-4-fluoro-(1)Benzothiopyrano(4,3-b)indole , its cas register number is 21243-26-5. It also can be called BRN 1582683 ; Thiopyrano(4,3-b)benz(e)indole, 6,11-dihydro-4-fluoro- ; (1)Benzothiopyrano(4,3-b)indole, 6,11-dihydro-4-fluoro- .When 6,11-Dihydro-4-fluoro-(1)Benzothiopyrano(4,3-b)indole (CAS NO.21243-26-5) is heated to decomposition, it emits very toxic fumes of F−, SOx, and NOx. |
| Flash Point: | 238.8°C |
| Safety Data | |
 |
|
