| Identification | |
| Name: | [1]Benzothiopyrano[4,3-b]indole,2-fluoro-6,11-dihydro- |
| Synonyms: | BRN 1582713;6,11-Dihydro-2-fluoro-(1)benzothiopyrano(4,3-b)indole;Thiopyrano(4,3-b)benz(e)indole, 6,11-dihydro-2-fluoro-;(1)BENZOTHIOPYRANO(4,3-b)INDOLE, 6,11-DIHYDRO-2-FLUORO-;AC1L1KZ4;LS-41386;2-fluoro-6,11-dihydrothiochromeno[4,3-b]indole;22298-04-0 |
| CAS: | 22298-04-0 |
| Molecular Formula: | C15H10 F N S |
| Molecular Weight: | 255.32 |
| InChI: | InChI=1/C15H10FNS/c16-9-5-6-14-11(7-9)15-12(8-18-14)10-3-1-2-4-13(10)17-15/h1-7,17H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 247.9°C |
| Boiling Point: | 486.4°C at 760 mmHg |
| Density: | 1.401g/cm3 |
| Refractive index: | 1.749 |
| Specification: |
6,11-Dihydro-2-fluoro-(1)benzothiopyrano(4,3-b)indole , its cas register number is 22298-04-0. It also can be called BRN 1582713 ; Thiopyrano(4,3-b)benz(e)indole, 6,11-dihydro-2-fluoro- .When heated to decomposition it emits very toxic fumes of F−, SOx, and NOx. |
| Flash Point: | 247.9°C |
| Safety Data | |
 |
|
