| Identification | |
| Name: | Benzene,1-bromo-3-isothiocyanato- |
| Synonyms: | Isothiocyanicacid, m-bromophenyl ester (7CI,8CI); 1-Bromo-3-isothiocyanatobenzene;3-Bromophenyl isothiocyanate; m-Bromophenyl isothiocyanate; m-Bromophenylisothiocyanate |
| CAS: | 2131-59-1 |
| EINECS: | 210-753-9 |
| Molecular Formula: | C7H4 Br N S |
| Molecular Weight: | 214.083 |
| InChI: | InChI=1S/C7H4BrNS/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 128.9°C |
| Boiling Point: | 256°Cat760mmHg |
| Density: | 1.5g/cm3 |
| Refractive index: | 1.685 |
| Appearance: | yellow liquid after melting |
| Specification: |
1-bromo-3-isothiocyanato-benzene , with CAS number of 2131-59-1, can be called 1-bromo-3-isothiocyanato-benzen ; 1-bromo-3-isothiocyanatobenzene ; benzene, 1-bromo-3-isothiocyanato- ; isothiocyanic acid, m-bromophenyl ester ; isothiocyanicacid,m-bromophenylester ; 3-bromophenyl isothiocyanate ; m-bromophenyl isothiocyanate ; isothiocyanic acid 3-bromophenyl ester . It is a yellow liquid after melting. |
| Packinggroup: | III |
| Flash Point: | 128.9°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
C: Corrosive
|
 |
|
