| Identification | |
| Name: | Benzene,1-chloro-3-isothiocyanato- |
| Synonyms: | Isothiocyanicacid, m-chlorophenyl ester (6CI,7CI,8CI);1-Chloro-3-isothiocyanatobenzene;3-Chlorophenyl isothiocyanate;NSC 132371;m-Chlorophenyl isothiocyanate; |
| CAS: | 2392-68-9 |
| EINECS: | -0 |
| Molecular Formula: | C7H4ClNS |
| Molecular Weight: | 169.62 |
| InChI: | InChI=1/C7H4ClNS/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 117.4°C |
| Density: | 1.29 |
| Refractive index: | 1.658-1.66 |
| Appearance: | clear yellow liquid |
| Specification: | clear yellow liquid Safety Statements:45-36/37/39-26-37/39 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 117.4°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
