Identification |
Name: | Benzene,1-chloro-3-isothiocyanato- |
Synonyms: | Isothiocyanicacid, m-chlorophenyl ester (6CI,7CI,8CI);1-Chloro-3-isothiocyanatobenzene;3-Chlorophenyl isothiocyanate;NSC 132371;m-Chlorophenyl isothiocyanate; |
CAS: | 2392-68-9 |
EINECS: | -0 |
Molecular Formula: | C7H4ClNS |
Molecular Weight: | 169.62 |
InChI: | InChI=1/C7H4ClNS/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
Molecular Structure: |
|
Properties |
Transport: | 2810 |
Flash Point: | 117.4°C |
Density: | 1.29 |
Refractive index: | 1.658-1.66 |
Appearance: | clear yellow liquid |
Specification: | clear yellow liquid Safety Statements:45-36/37/39-26-37/39 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Packinggroup: | III |
Flash Point: | 117.4°C |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|