| Identification | |
| Name: | 2-Ethoxyphenylboronic acid |
| Synonyms: | Boronicacid, (2-ethoxyphenyl)- (9CI);(2-Ethyloxyphenyl)boronic acid;2-(Ethoxy)benzeneboronic acid;Boronicacid, B-(2-ethoxyphenyl)-; |
| CAS: | 213211-69-9 |
| Molecular Formula: | C8H11BO3 |
| Molecular Weight: | 165.98 |
| InChI: | InChI=1S/C8H11BO3/c1-2-12-8-6-4-3-5-7(8)9(10)11/h3-6,10-11H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 152.7 °C |
| Boiling Point: | 328.8 °C at 760mmHg |
| Density: | 1.13 g/cm3 |
| Refractive index: | 1.518 |
| Appearance: | white to off-white crystals or crystalline powder |
| Specification: |
2-Ethoxyphenylboronic acid (CAS NO.213211-69-9) is also named as Boronicacid, B-(2-ethoxyphenyl)- ; 2-(Ethoxy)benzeneboronic acid ; (2-Ethyloxyphenyl)boronic acid . 2-Ethoxyphenylboronic acid (CAS NO.213211-69-9) is white to off-white crystals or crystalline powder. |
| Flash Point: | 152.7 °C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
