| Identification |
| Name: | 2-Thiophenemethanol,5,5'-(2,5-furandiyl)bis- |
| Synonyms: | NSC 652287 |
| CAS: | 213261-59-7 |
| Molecular Formula: | C14H12 O3 S2 |
| Molecular Weight: | 292.37328 |
| InChI: | InChI=1/C14H12O3S2/c15-7-9-1-5-13(18-9)11-3-4-12(17-11)14-6-2-10(8-16)19-14/h1-6,15-16H,7-8H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 235°C |
| Boiling Point: | 464.9°Cat760mmHg |
| Density: | 1.396g/cm3 |
| Refractive index: | 1.661 |
| Biological Activity: | Anti-tumor agent that binds wild-type p53 (K d = 1.5 nM) preventing p53-MDM2 (HDM2) interaction. Induces p53 accumulation and stimulates apoptosis in tumor cell lines expressing wild-type p53 in vitro and in vivo . |
| Flash Point: | 235°C |
| Safety Data |
| |
 |
