| Identification |
| Name: | sodium dichloroacetate |
| Synonyms: | Dichloroacetic acid sodium salt |
| CAS: | 2156-56-1 |
| EINECS: | 218-461-3 |
| Molecular Formula: | C2HCl2NaO2 |
| Molecular Weight: | 150.92 |
| InChI: | InChI=1/C2H2Cl2O2.Na/c3-1(4)2(5)6;/h1H,(H,5,6);/q;+1/p-1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Flash Point: | 194°Cat760mmHg |
| Boiling Point: | 194°Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble in cold water |
| Appearance: | White powder. |
| Biological Activity: | Inhibitor of mitochondrial pyruvate dehydrogenase kinase (PDK). Shifts pyruvate metabolism from glycolysis and lactate production to glucose oxidation in the mitochondria. Induces mitochondrial-dependent apoptosis and reverses the inhibition/downregulation of K V 1.5 channels in cancer but not normal cells. Decreases tumor growth in vitro and in vivo . |
| Flash Point: | 194°Cat760mmHg |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
