| Identification | |
| Name: | Pyridine,3-(1-methyl-2-pyrrolidinyl)- |
| CAS: | 22083-74-5 |
| Molecular Formula: | C10H14 N2 |
| Molecular Weight: | 162.23 |
| InChI: | InChI=1/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1654 6.1/PG 2 |
| Melting Point: | -79 deg C |
| Flash Point: | 101.7°C |
| Boiling Point: | 244.4°Cat760mmHg |
| Density: | 1.032g/cm3 |
| Refractive index: | 1.539 |
| Solubility: | Miscible with water below 60 deg C; very sol in alcohol, chloroform, ether, petroleum ether, kerosene, oils Slightly soluble in ligroin In water, 1X10+6 mg/L at 25 deg C (miscible) |
| Flash Point: | 101.7°C |
| Color: | yellow |
| Usage: | This is the unnatural isomer of Nicotine |
| Safety Data | |
| Hazard Symbols |
T+: Very toxic
N: Dangerous for the environment
|
 |
|
