| Identification | |
| Name: | 5H-Dibenzo[a,d]cyclohepten-5-one |
| Synonyms: | 2,3:6,7-Dibenzotropone;5H-Dibenzo[a,d]cycloheptenone;Dibenzo[a,d]cyclohepten-5-one;Dibenzosuberenone;NSC 86151;dibenzo[a,b]cyclohepten-5-one; |
| CAS: | 2222-33-5 |
| EINECS: | 218-737-3 |
| Molecular Formula: | C15H10O |
| Molecular Weight: | 206.24 |
| InChI: | InChI=1/C15H10O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-10H |
| Molecular Structure: | ![(C15H10O) 2,3:6,7-Dibenzotropone;5H-Dibenzo[a,d]cycloheptenone;Dibenzo[a,d]cyclohepten-5-one;Dibenzosuberenone...](https://img.guidechem.com/casimg/2222-33-5.gif) |
| Properties | |
| Transport: | 50kgs |
| Density: | 1.188 g/cm3 |
| Refractive index: | 1.642 |
| Water Solubility: | 4 mg/l at 23 C |
| Solubility: | 4 mg/l at 23 C |
| Appearance: | off-white to brownish crystals |
| Specification: | white to pale yellow or beige crystalline powder usageEng:Can be used in the synthesis of a series of potent antidepressants. Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Storage Temperature: | Refrigerator |
| Usage: | Can be used in the synthesis of a series of potent antidepressants. |
| Safety Data | |
| Hazard Symbols | |
 |
|
