| Identification | |
| Name: | 3-Heptanone, 5-methyl-,oxime |
| Synonyms: | 5-Methyl-3-heptanoneoxime; Ethyl 2-methylbutyl ketoxime; NSC 166310; Stemone |
| CAS: | 22457-23-4 |
| EINECS: | 245-010-8 |
| Molecular Formula: | C8H17 N O |
| Molecular Weight: | 143.26 |
| InChI: | InChI=1/C8H17NO/c1-4-7(3)6-8(5-2)9-10/h7,10H,4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 119.6°C |
| Boiling Point: | 220.8°Cat760mmHg |
| Density: | 0.89g/cm3 |
| Refractive index: | 1.445 |
| Specification: |
Ethyl 2-methylbutyl ketoxine ,its cas register number is 22457-23-4. It also can be called Ethyl 2-methylbutyl ketoxime ; 5-Methylheptan-3-one oxime ; and 3-Heptanone, 5-methyl-, oxim . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 119.6°C |
| Safety Data | |
 |
|
