Identification |
Name: | 3-Heptanone, 5-methyl-,oxime |
Synonyms: | 5-Methyl-3-heptanoneoxime; Ethyl 2-methylbutyl ketoxime; NSC 166310; Stemone |
CAS: | 22457-23-4 |
EINECS: | 245-010-8 |
Molecular Formula: | C8H17 N O |
Molecular Weight: | 143.26 |
InChI: | InChI=1/C8H17NO/c1-4-7(3)6-8(5-2)9-10/h7,10H,4-6H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 119.6°C |
Boiling Point: | 220.8°Cat760mmHg |
Density: | 0.89g/cm3 |
Refractive index: | 1.445 |
Specification: |
Ethyl 2-methylbutyl ketoxine ,its cas register number is 22457-23-4. It also can be called Ethyl 2-methylbutyl ketoxime ; 5-Methylheptan-3-one oxime ; and 3-Heptanone, 5-methyl-, oxim .
|
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 119.6°C |
Safety Data |
|
 |