| Identification | |
| Name: | 3-Heptanone, 5-methyl- |
| CAS: | 541-85-5 |
| EINECS: | 208-793-7 |
| Molecular Formula: | C8H16 O |
| Molecular Weight: | 128.24 |
| InChI: | InChI=1/C8H16O/c1-4-7(3)6-8(9)5-2/h7H,4-6H2,1-3H3/t7-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2271 3/PG 3 |
| Flash Point: | 43.9°C |
| Boiling Point: | 159.9°Cat760mmHg |
| Density: | 0.811g/cm3 |
| Refractive index: | 1.409 |
| Specification: | CLEAR LIGHT YELLOW LIQUID Safety Statements:23 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 43.9°C |
| Safety Data | |
 |
|
