| Identification |
| Name: | Benzaldehyde,3-ethoxy- |
| Synonyms: | Benzaldehyde,m-ethoxy- (7CI,8CI);m-Ethoxybenzaldehyde; |
| CAS: | 22924-15-8 |
| EINECS: | 245-333-4 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.17 |
| InChI: | InChI=1/C9H10O2/c1-2-11-9-5-3-4-8(6-9)7-10/h3-7H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 21 |
| Flash Point: | 106.6 ºC |
| Density: | 1.07 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.539-1.541 |
| Solubility: | Insoluble |
| Appearance: | colorless to brown-yellow clear liquid |
| Flash Point: | 106.6 ºC |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
