| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 1,2,3,6-tetrahydro-1-(phenylmethyl)-, ethyl ester |
| Synonyms: | Isonicotinicacid, 1-benzyl-1,2,3,6-tetrahydro-, ethyl ester (8CI);Ethyl 1-benzyl-1,2,3,6-tetrahydropyridine-4-carboxylate; |
| CAS: | 23019-62-7 |
| Molecular Formula: | C15H19NO2 |
| Molecular Weight: | 245.32 |
| InChI: | InChI=1/C15H19NO2/c1-2-18-15(17)14-8-10-16(11-9-14)12-13-6-4-3-5-7-13/h3-8H,2,9-12H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 121 ºC |
| Boiling Point: | 344 ºC |
| Density: | 1.108 |
| Refractive index: | 1.554 |
| Specification: |
The Ethyl 1-benzyl-1,2,3,6-tetrahydropyridine-4-carboxylate with the cas number 23019-62-7 is also called 4-Pyridinecarboxylicacid, 1,2,3,6-tetrahydro-1-(phenylmethyl)-, ethyl ester. Its molecular formula is C15H19NO2. The product category is API intermediates. The properties of the chemical are: (1)ACD/LogP: 3.23; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 5; (6)Polar Surface Area: 29.54 Å2; (7)Index of Refraction: 1.554; (8)Molar Refractivity: 70.97 cm3; (9)Molar Volume: 221.2 cm3; (10)Polarizability: 28.13×10-24cm3; (11)Surface Tension: 44.2 dyne/cm; (12)Enthalpy of Vaporization: 58.79 kJ/mol; (13)Vapour Pressure: 6.78×10-5 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 121 ºC |
| Safety Data | |
 |
|
