| Identification | |
| Name: | 5-Fluorocytidine |
| Synonyms: | Cytidine, 5-fluoro- |
| CAS: | 2341-22-2 |
| EINECS: | 234-122-2 |
| Molecular Formula: | C9H12FN3O5 |
| Molecular Weight: | 261.21 |
| InChI: | InChI=1/C9H12FN3O5/c10-3-1-13(9(17)12-7(3)11)8-6(16)5(15)4(2-14)18-8/h1,4-6,8,14-16H,2H2,(H2,11,12,17)/t4-,5-,6-,8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Flash Point: | 263.1oC |
| Boiling Point: | 511.4oCat 760 mmHg |
| Density: | 1.98 g/cm3 |
| Alpha: | 55 o (C=1, MEOH) |
| Appearance: | white powder |
| Specification: | White Powder usageEng:5-Fluoropyrimidine nucleotides as probes of RNA structure using 19F-NMR spectroscopy Safety Statements:26-36-45-36/37/39-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing |
| Flash Point: | 263.1oC |
| Storage Temperature: | -20?C Freezer |
| Usage: | 5-Fluoropyrimidine nucleotides as probes of RNA structure using 19F-NMR spectroscopy |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
