| Identification | |
| Name: | 4H-1,3-Benzoxazin-4-one,2,3-dihydro-6-methyl-2-thioxo- |
| Synonyms: | 2H-1,3-Benzoxazine-2,4(3H)-dione,6-methyl-2-thio- (8CI) |
| CAS: | 23611-64-5 |
| Molecular Formula: | C9H7 N O2 S |
| Molecular Weight: | 193.23 |
| InChI: | InChI=1/C9H7NO2S/c1-5-2-3-7-6(4-5)8(11)10-9(13)12-7/h2-4H,1H3,(H,10,11,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.41g/cm3 |
| Refractive index: | 1.675 |
| Specification: |
6-Methyl-2-thio-2H-1,3-benzoxazine-2,4(3H)-dione , its cas register number is 23611-64-5. It also can be called 2H-1,3-Benzoxazine-2,4(3H)-dione, 6-methyl-2-thio- . When heated to decomposition it emits toxic vapors of NOx and SOx. |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
