| Identification | |
| Name: | 4H-1,3-Benzoxazin-4-one,6-bromo-2,3-dihydro-2-thioxo- |
| Synonyms: | 2H-1,3-Benzoxazine-2,4(3H)-dione,6-bromo-2-thio- (8CI) |
| CAS: | 23611-66-7 |
| Molecular Formula: | C8H4 Br N O2 S |
| Molecular Weight: | 258.10 |
| InChI: | InChI=1/C8H4BrNO2S/c9-4-1-2-6-5(3-4)7(11)10-8(13)12-6/h1-3H,(H,10,11,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.93g/cm3 |
| Refractive index: | 1.75 |
| Specification: |
6-Bromo-2-thio-2H-1,3-benzoxazine-2,4(3H)-dione , its cas register number is 23611-66-7. It also can be called 2H-1,3-Benzoxazine-2,4(3H)-dione, 6-bromo-2-thio- . When 6-Bromo-2-thio-2H-1,3-benzoxazine-2,4(3H)-dione (CAS NO.23611-66-7) is heated to decomposition, it emits toxic vapors of NOx, SOx, and Br−. |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
