| Identification | |
| Name: | D-Mannopyranose, 3-O-a-D-mannopyranosyl- |
| Synonyms: | Mannopyranose,3-O-a-D-mannopyranosyl-, D- (8CI); a-1,3-Mannobiose |
| CAS: | 23745-85-9 |
| Molecular Formula: | C12H22 O11 |
| Molecular Weight: | 342.3 |
| InChI: | InChI=1/C12H22O11/c13-1-3-5(15)7(17)8(18)12(22-3)23-10-6(16)4(2-14)21-11(20)9(10)19/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9+,10+,11?,12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 371.4°C |
| Boiling Point: | 690.5°C at 760 mmHg |
| Density: | 1.76g/cm3 |
| Refractive index: | 1.652 |
| Flash Point: | 371.4°C |
| Storage Temperature: | −20°C |
| Usage: | Believed to be the major antigenic determinant in the cell wall of yeast. An inhibitor of fibril lectins from enterobacteria |
| Safety Data | |
 |
|
