| Identification |
| Name: | 4-oxo-4H-1-benzopyran-2-carboxylic acid, compound with diethylamine (1:1) |
| Synonyms: | Fludarene;4-Oxo-4H-1-benzopyran-2-carboxylic acid compd. with N-ethylethanamine (1:1);Angiophtal;Campel;Chromocarb diethylamine;Chromocarbe diethylamine;Diethylamine chromone-carboxylate-2;UNII-R0O8TF63DH;4-Oxo-4H-1-benzopyran-2-carboxylic acid, compound with diethylamine (1:1);4H-1-Benzopyran-2-cabroxylic, 4-oxo-, compd. with diethylamine (1:1) (8CI);4H-1-Benzopyran-2-carboxylic acid, 4-oxo-, compd. with N-ethylethanamine (1:1);4-oxo-4H-chromene-2-carboxylic acid - N-ethylethanamine (1:1) |
| CAS: | 23915-80-2 |
| EINECS: | 245-939-9 |
| Molecular Formula: | C14H17NO4 |
| Molecular Weight: | 263.2891 |
| InChI: | InChI=1/C10H6O4.C4H11N/c11-7-5-9(10(12)13)14-8-4-2-1-3-6(7)8;1-3-5-4-2/h1-5H,(H,12,13);5H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 138.9°C |
| Boiling Point: | 337°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 138.9°C |
| Safety Data |
| |
 |
