| Identification |
| Name: | 2-Naphthaleneaceticacid, 6-methoxy- |
| Synonyms: | 2-(6-Methoxy-2-naphthyl)aceticacid; 6-Methoxy-2-naphthaleneacetic acid; 6-Methoxy-2-naphthylacetic acid; BRL10720 |
| CAS: | 23981-47-7 |
| EINECS: | 245-967-1 |
| Molecular Formula: | C13H12 O3 |
| Molecular Weight: | 216.23258 |
| InChI: | InChI=1S/C13H12O3/c1-16-12-5-4-10-6-9(7-13(14)15)2-3-11(10)8-12/h2-6,8H,7H2,1H3,(H,14,15) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.235 g/cm3 |
| Refractive index: | 1.625 |
| Water Solubility: | Soluble in DMSO (25 mg/mL) and ethanol (10 mg/mL warm) |
| Solubility: | Soluble in DMSO (25 mg/mL) and ethanol (10 mg/mL warm) |
| Appearance: | Off-white solid |
| Usage: | A metabolite of Nabumetone. A competitive, non-selective COX inhibitor |
| Safety Data |
| |
 |
