| Identification | |
| Name: | 2-Naphthaleneaceticacid, 6-hydroxy-a-methyl-,(aS)- |
| Synonyms: | 2-Naphthaleneaceticacid, 6-hydroxy-a-methyl-,(S)-; (+)-2-(6-Hydroxy-2-naphthyl)propionic acid; (S)-2-(6-Hydroxy-2-naphthyl)propionicacid; (S)-6-O-Desmethylnaproxen; 6-Demethylnaproxen; 6-Desmethylnaproxen;6-Hydroxynaproxen; 6-O-Demethylnaproxen; O-Desmethylnaproxen |
| CAS: | 52079-10-4 |
| Molecular Formula: | C13H12 O3 |
| Molecular Weight: | 216.23 |
| InChI: | InChI=1/C12H10O3.CH4/c13-11-4-3-9-5-8(6-12(14)15)1-2-10(9)7-11;/h1-5,7,13H,6H2,(H,14,15);1H4 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Melting Point: | 182-183 °C |
| Flash Point: | 236.5°C |
| Boiling Point: | 444.1°Cat760mmHg |
| Density: | g/cm3 |
| Specification: | Off-Whie to Pale Pink Solid usageEng:A metabolite of Naproxen Safety Statements:36/37-60-61 36/37:Wear suitable protective clothing and gloves 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 236.5°C |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Usage: | A metabolite of Naproxen |
| Safety Data | |
 |
|
