| Identification |
| Name: | Benzene,1,2-dichloro-3-iodo- |
| Synonyms: | 2,3-Dichloro-1-iodobenzene; |
| CAS: | 2401-21-0 |
| EINECS: | 219-276-0 |
| Molecular Formula: | C6H3Cl2I |
| Molecular Weight: | 272.9 |
| InChI: | InChI=1/C6H3Cl2I/c7-4-2-1-3-5(9)6(4)8/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Density: | 2.015g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.642 |
| Solubility: | Insoluble |
| Appearance: | white to light yellow crystal |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
