Identification |
Name: | Benzene,1-chloro-3-iodo-2-methyl- |
Synonyms: | 2-Iodo-6-chlorotoluene;2-Chloro-6-iodotoluene;1-Chloro-3-iodo-2-methylbenzene; |
CAS: | 42048-11-3 |
Molecular Formula: | C7H6ClI |
Molecular Weight: | 252.48 |
InChI: | InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | 11°C |
Boiling Point: | 119-120°C 15mm |
Density: | 1.82 |
Refractive index: | 1.6273 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Storage Temperature: | Refrigerated. |
Sensitive: | Light Sensitive |
Safety Data |
|
 |